C9H21ClN2OS — CID 120506117
N-[(2S)-1-aminopropan-2-yl]-2-tert-butylsulfanylacetamide;hydrochloride (PubChem CID 120506117) has the molecular formula C9H21ClN2OS and a molecular weight of 240.80 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2-tert-butylsulfanylacetamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2-tert-butylsulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120506117 |
| Molecular Formula | C9H21ClN2OS |
| Molecular Weight | 240.80 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2-tert-butylsulfanylacetamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)CSC(C)(C)C.Cl |
| InChI | InChI=1S/C9H20N2OS.ClH/c1-7(5-10)11-8(12)6-13-9(2,3)4;/h7H,5-6,10H2,1-4H3,(H,11,12);1H/t7-;/m0./s1 |
| InChIKey | IZNZNCLHXQNTEF-FJXQXJEOSA-N |
| XLogP | 1.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.80 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |