C10H23ClN2OS — CID 120829687
2-tert-butylsulfanyl-N-[2-(methylamino)propyl]acetamide;hydrochloride (PubChem CID 120829687) has the molecular formula C10H23ClN2OS and a molecular weight of 254.83 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-[2-(methylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-tert-butylsulfanyl-N-[2-(methylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120829687 |
| Molecular Formula | C10H23ClN2OS |
| Molecular Weight | 254.83 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-tert-butylsulfanyl-N-[2-(methylamino)propyl]acetamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)CSC(C)(C)C.Cl |
| InChI | InChI=1S/C10H22N2OS.ClH/c1-8(11-5)6-12-9(13)7-14-10(2,3)4;/h8,11H,6-7H2,1-5H3,(H,12,13);1H |
| InChIKey | CTKMDCSXIAGRAN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.83 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |