C12H28Cl2N4O — CID 120828236
2-(4-ethylpiperazin-1-yl)-N-[2-(methylamino)propyl]acetamide;dihydrochloride (PubChem CID 120828236) has the molecular formula C12H28Cl2N4O and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N-[2-(methylamino)propyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N-[2-(methylamino)propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120828236 |
| Molecular Formula | C12H28Cl2N4O |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N-[2-(methylamino)propyl]acetamide;dihydrochloride |
| SMILES | CCN1CCN(CC(=O)NCC(C)NC)CC1.Cl.Cl |
| InChI | InChI=1S/C12H26N4O.2ClH/c1-4-15-5-7-16(8-6-15)10-12(17)14-9-11(2)13-3;;/h11,13H,4-10H2,1-3H3,(H,14,17);2*1H |
| InChIKey | JLUFXOFLGMPUNJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |