C11H21ClN4O3 — CID 120827233
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride (PubChem CID 120827233) has the molecular formula C11H21ClN4O3 and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120827233 |
| Molecular Formula | C11H21ClN4O3 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)CN1C(=O)NC(C)(C)C1=O.Cl |
| InChI | InChI=1S/C11H20N4O3.ClH/c1-7(12-4)5-13-8(16)6-15-9(17)11(2,3)14-10(15)18;/h7,12H,5-6H2,1-4H3,(H,13,16)(H,14,18);1H |
| InChIKey | LCTLFCWAQGBOFD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|