C14H22ClN3O4 — CID 120832567
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride (PubChem CID 120832567) has the molecular formula C14H22ClN3O4 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120832567 |
| Molecular Formula | C14H22ClN3O4 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[2-(methylamino)propyl]acetamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)CN1C(=O)C2C3CCC(O3)C2C1=O.Cl |
| InChI | InChI=1S/C14H21N3O4.ClH/c1-7(15-2)5-16-10(18)6-17-13(19)11-8-3-4-9(21-8)12(11)14(17)20;/h7-9,11-12,15H,3-6H2,1-2H3,(H,16,18);1H |
| InChIKey | JJNZCHNBBHFMHX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|