C18H18N2O6 — CID 119372320
(2S)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetyl]amino]-2-phenylacetic acid (PubChem CID 119372320) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2S)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetyl]amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119372320 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2S)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetyl]amino]-2-phenylacetic acid |
| SMILES | O=C(CN1C(=O)C2C3CCC(O3)C2C1=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O6/c21-12(19-15(18(24)25)9-4-2-1-3-5-9)8-20-16(22)13-10-6-7-11(26-10)14(13)17(20)23/h1-5,10-11,13-15H,6-8H2,(H,19,21)(H,24,25)/t10?,11?,13?,14?,15-/m0/s1 |
| InChIKey | PNRDDJZSCIWXFR-ATBBQKOXSA-N |
| XLogP | 0.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|