C13H13N3O5 — CID 43358379
2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-2-phenylacetic acid (PubChem CID 43358379) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 43358379 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-2-phenylacetic acid |
| SMILES | O=C(CN1C(=O)CNC1=O)NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O5/c17-9(7-16-10(18)6-14-13(16)21)15-11(12(19)20)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,14,21)(H,15,17)(H,19,20) |
| InChIKey | VNBDEBMYVOUEHB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|