C8H11N3O6 — CID 43357583
2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 43357583) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 43357583 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[[2-(2,5-dioxoimidazolidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | O=C(CN1C(=O)CNC1=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C8H11N3O6/c12-3-4(7(15)16)10-5(13)2-11-6(14)1-9-8(11)17/h4,12H,1-3H2,(H,9,17)(H,10,13)(H,15,16) |
| InChIKey | LOLAPFRYGUIZIJ-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|