C16H19N3O5 — CID 119367892
(2R)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]-2-phenylacetic acid (PubChem CID 119367892) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119367892 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (2R)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]-2-phenylacetic acid |
| SMILES | CN1CC(=O)N(CCCC(=O)N[C@@H](C(=O)O)c2ccccc2)C1=O |
| InChI | InChI=1S/C16H19N3O5/c1-18-10-13(21)19(16(18)24)9-5-8-12(20)17-14(15(22)23)11-6-3-2-4-7-11/h2-4,6-7,14H,5,8-10H2,1H3,(H,17,20)(H,22,23)/t14-/m1/s1 |
| InChIKey | QPGUOKPUVAQWSG-CQSZACIVSA-N |
| XLogP | 0.60 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|