C17H23NO4 — CID 166385936
(2S)-2-[(6,6-dimethyl-5-oxoheptanoyl)amino]-2-phenylacetic acid (PubChem CID 166385936) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2S)-2-[(6,6-dimethyl-5-oxoheptanoyl)amino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(6,6-dimethyl-5-oxoheptanoyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 166385936 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2S)-2-[(6,6-dimethyl-5-oxoheptanoyl)amino]-2-phenylacetic acid |
| SMILES | CC(C)(C)C(=O)CCCC(=O)N[C@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)13(19)10-7-11-14(20)18-15(16(21)22)12-8-5-4-6-9-12/h4-6,8-9,15H,7,10-11H2,1-3H3,(H,18,20)(H,21,22)/t15-/m0/s1 |
| InChIKey | ZNBUUNDNYLTJMV-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |