C16H22N2O4 — CID 119367976
(2R)-2-[[5-oxo-5-(propan-2-ylamino)pentanoyl]amino]-2-phenylacetic acid (PubChem CID 119367976) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R)-2-[[5-oxo-5-(propan-2-ylamino)pentanoyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[5-oxo-5-(propan-2-ylamino)pentanoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 119367976 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2R)-2-[[5-oxo-5-(propan-2-ylamino)pentanoyl]amino]-2-phenylacetic acid |
| SMILES | CC(C)NC(=O)CCCC(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-11(2)17-13(19)9-6-10-14(20)18-15(16(21)22)12-7-4-3-5-8-12/h3-5,7-8,11,15H,6,9-10H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)/t15-/m1/s1 |
| InChIKey | NPFRONINQWZLEP-OAHLLOKOSA-N |
| XLogP | 1.62 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |