C9H13N3O5 — CID 43170513
2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid (PubChem CID 43170513) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 43170513 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-[[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid |
| SMILES | CC1(C)NC(=O)N(CC(=O)NCC(=O)O)C1=O |
| InChI | InChI=1S/C9H13N3O5/c1-9(2)7(16)12(8(17)11-9)4-5(13)10-3-6(14)15/h3-4H2,1-2H3,(H,10,13)(H,11,17)(H,14,15) |
| InChIKey | XVXUABCQUKJERG-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|