C11H16N2O5 — CID 62932062
2-[[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)acetyl]amino]acetic acid (PubChem CID 62932062) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 62932062 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[[2-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)acetyl]amino]acetic acid |
| SMILES | CC1(C)CC(=O)N(CC(=O)NCC(=O)O)C(=O)C1 |
| InChI | InChI=1S/C11H16N2O5/c1-11(2)3-8(15)13(9(16)4-11)6-7(14)12-5-10(17)18/h3-6H2,1-2H3,(H,12,14)(H,17,18) |
| InChIKey | JBIBHDNDZLHCHL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|