2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid

C7H10N2O4S — CID 43170515

IUPAC2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid
SMILESO=C(O)CNC(=O)CN1CSCC1=O
InChIInChI=1S/C7H10N2O4S/c10-5(8-1-7(12)13)2-9-4-14-3-6(9)11/h1-4H2,(H,8,10)(H,12,13)
InChIKeyUCIGACBRIFMYJW-UHFFFAOYSA-N
MW218.23 g/mol
LogP-1.28
Rot. Bonds4

About 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid

2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid (PubChem CID 43170515) has the molecular formula C7H10N2O4S and a molecular weight of 218.23 g/mol. Its IUPAC name is 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid
PubChem CID43170515
Molecular FormulaC7H10N2O4S
Molecular Weight218.23 g/mol
Exact Mass218.04
IUPAC Name2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid
SMILESO=C(O)CNC(=O)CN1CSCC1=O
InChIInChI=1S/C7H10N2O4S/c10-5(8-1-7(12)13)2-9-4-14-3-6(9)11/h1-4H2,(H,8,10)(H,12,13)
InChIKeyUCIGACBRIFMYJW-UHFFFAOYSA-N
XLogP-1.28
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.23
LogP ≤ 5-1.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid?
The IUPAC name of 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid (CID 43170515) is 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid?
The canonical SMILES for 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid is O=C(O)CNC(=O)CN1CSCC1=O.
What is the InChIKey of 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid?
The InChIKey is UCIGACBRIFMYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S/c10-5(8-1-7(12)13)2-9-4-14-3-6(9)11/h1-4H2,(H,8,10)(H,12,13).
What are the key properties of 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid?
2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid has a molecular weight of 218.23 g/mol, XLogP of -1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]acetic acid is sourced from PubChem (CID 43170515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).