About 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid
3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid (PubChem CID 43354693) has the molecular formula C8H12N2O4S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid.
Analyze 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid?
The IUPAC name of 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid (CID 43354693) is 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid.
What is the SMILES notation for 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid?
The canonical SMILES for 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid is O=C(O)CCNC(=O)CN1CSCC1=O.
What is the InChIKey of 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid?
The InChIKey is KBZDZULWWSVJJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S/c11-6(9-2-1-8(13)14)3-10-5-15-4-7(10)12/h1-5H2,(H,9,11)(H,13,14).
What are the key properties of 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid?
3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid has a molecular weight of 232.26 g/mol, XLogP of -0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(4-oxo-1,3-thiazolidin-3-yl)acetyl]amino]propanoic acid is sourced from PubChem (CID 43354693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).