C14H26ClN3O2S — CID 119621270
N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide;hydrochloride (PubChem CID 119621270) has the molecular formula C14H26ClN3O2S and a molecular weight of 335.90 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119621270 |
| Molecular Formula | C14H26ClN3O2S |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(4-oxo-1,3-thiazolidin-3-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CSCC1=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C14H25N3O2S.ClH/c18-13(9-17-11-20-10-14(17)19)16-8-7-15-12-5-3-1-2-4-6-12;/h12,15H,1-11H2,(H,16,18);1H |
| InChIKey | BNEYJXCMAHHHKJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|