C19H26ClN3O3 — CID 119620644
N-[2-(cycloheptylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride (PubChem CID 119620644) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119620644 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1C(=O)c2ccccc2C1=O)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C19H25N3O3.ClH/c23-17(21-12-11-20-14-7-3-1-2-4-8-14)13-22-18(24)15-9-5-6-10-16(15)19(22)25;/h5-6,9-10,14,20H,1-4,7-8,11-13H2,(H,21,23);1H |
| InChIKey | BVUHNSCKSOWNPL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|