C21H32ClN3O2 — CID 119619374
N-[2-(cycloheptylamino)ethyl]-3-(2-oxo-3,4-dihydroquinolin-1-yl)propanamide;hydrochloride (PubChem CID 119619374) has the molecular formula C21H32ClN3O2 and a molecular weight of 393.96 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-(2-oxo-3,4-dihydroquinolin-1-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-(2-oxo-3,4-dihydroquinolin-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119619374 |
| Molecular Formula | C21H32ClN3O2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-(2-oxo-3,4-dihydroquinolin-1-yl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCN1C(=O)CCc2ccccc21)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H31N3O2.ClH/c25-20(23-15-14-22-18-8-3-1-2-4-9-18)13-16-24-19-10-6-5-7-17(19)11-12-21(24)26;/h5-7,10,18,22H,1-4,8-9,11-16H2,(H,23,25);1H |
| InChIKey | NKJIOFCEVJBXMX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|