C21H31ClN4O3 — CID 119620738
N-[2-(cycloheptylamino)ethyl]-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide;hydrochloride (PubChem CID 119620738) has the molecular formula C21H31ClN4O3 and a molecular weight of 422.96 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119620738 |
| Molecular Formula | C21H31ClN4O3 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide;hydrochloride |
| SMILES | Cl.O=C(CCC(=O)N1CC(=O)Nc2ccccc21)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H30N4O3.ClH/c26-19(23-14-13-22-16-7-3-1-2-4-8-16)11-12-21(28)25-15-20(27)24-17-9-5-6-10-18(17)25;/h5-6,9-10,16,22H,1-4,7-8,11-15H2,(H,23,26)(H,24,27);1H |
| InChIKey | FMDUHOKFSRMFLH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|