C19H25N3O3 — CID 35806320
N-cycloheptyl-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide (PubChem CID 35806320) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-cycloheptyl-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide.
| Compound Name | N-cycloheptyl-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide |
|---|---|
| PubChem CID | 35806320 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-cycloheptyl-4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butanamide |
| SMILES | O=C1CN(C(=O)CCC(=O)NC2CCCCCC2)c2ccccc2N1 |
| InChI | InChI=1S/C19H25N3O3/c23-17(20-14-7-3-1-2-4-8-14)11-12-19(25)22-13-18(24)21-15-9-5-6-10-16(15)22/h5-6,9-10,14H,1-4,7-8,11-13H2,(H,20,23)(H,21,24) |
| InChIKey | FPNZBVUEKARPSR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |