C18H26N3O2+ — CID 9265031
cyclooctyl-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]azanium (PubChem CID 9265031) has the molecular formula C18H26N3O2+ and a molecular weight of 316.42 g/mol. Its IUPAC name is cyclooctyl-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]azanium.
| Compound Name | cyclooctyl-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 9265031 |
| Molecular Formula | C18H26N3O2+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | cyclooctyl-[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl]azanium |
| SMILES | O=C1CN(C(=O)C[NH2+]C2CCCCCCC2)c2ccccc2N1 |
| InChI | InChI=1S/C18H25N3O2/c22-17-13-21(16-11-7-6-10-15(16)20-17)18(23)12-19-14-8-4-2-1-3-5-9-14/h6-7,10-11,14,19H,1-5,8-9,12-13H2,(H,20,22)/p+1 |
| InChIKey | ZPDUFOJRURRWCG-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |