C15H18N2O2S — CID 80708962
4-[2-(thian-4-yl)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 80708962) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-[2-(thian-4-yl)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(thian-4-yl)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 80708962 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[2-(thian-4-yl)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)CC2CCSCC2)c2ccccc2N1 |
| InChI | InChI=1S/C15H18N2O2S/c18-14-10-17(13-4-2-1-3-12(13)16-14)15(19)9-11-5-7-20-8-6-11/h1-4,11H,5-10H2,(H,16,18) |
| InChIKey | TUQPPPSRTWHAJI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |