C10H9N3O3 — CID 54465544
4-(2-nitrosoacetyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 54465544) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-(2-nitrosoacetyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(2-nitrosoacetyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 54465544 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-(2-nitrosoacetyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=NCC(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H9N3O3/c14-9-6-13(10(15)5-11-16)8-4-2-1-3-7(8)12-9/h1-4H,5-6H2,(H,12,14) |
| InChIKey | XEOLLALFIGOWMV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |