C16H13BrN2O2S — CID 27087539
4-[2-(2-bromophenyl)sulfanylacetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 27087539) has the molecular formula C16H13BrN2O2S and a molecular weight of 377.26 g/mol. Its IUPAC name is 4-[2-(2-bromophenyl)sulfanylacetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(2-bromophenyl)sulfanylacetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 27087539 |
| Molecular Formula | C16H13BrN2O2S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 4-[2-(2-bromophenyl)sulfanylacetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)CSc2ccccc2Br)c2ccccc2N1 |
| InChI | InChI=1S/C16H13BrN2O2S/c17-11-5-1-4-8-14(11)22-10-16(21)19-9-15(20)18-12-6-2-3-7-13(12)19/h1-8H,9-10H2,(H,18,20) |
| InChIKey | XSQHSBIDHQBAFT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |