C13H15BrN2O2 — CID 28822186
4-[(2S)-2-bromo-3-methylbutanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 28822186) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-[(2S)-2-bromo-3-methylbutanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(2S)-2-bromo-3-methylbutanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 28822186 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-[(2S)-2-bromo-3-methylbutanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CC(C)[C@H](Br)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H15BrN2O2/c1-8(2)12(14)13(18)16-7-11(17)15-9-5-3-4-6-10(9)16/h3-6,8,12H,7H2,1-2H3,(H,15,17)/t12-/m0/s1 |
| InChIKey | FEDLSQZRFIEOEB-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|