C19H27N3O2 — CID 8558893
4-[(2S)-2-(cyclooctylamino)propanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 8558893) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[(2S)-2-(cyclooctylamino)propanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(2S)-2-(cyclooctylamino)propanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 8558893 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 4-[(2S)-2-(cyclooctylamino)propanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C[C@H](NC1CCCCCCC1)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H27N3O2/c1-14(20-15-9-5-3-2-4-6-10-15)19(24)22-13-18(23)21-16-11-7-8-12-17(16)22/h7-8,11-12,14-15,20H,2-6,9-10,13H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | SJQLYOOUYVLNFD-AWEZNQCLSA-N |
| XLogP | 3.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |