C12H14N4O3 — CID 95040569
[(2S)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]urea (PubChem CID 95040569) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]urea.
| Compound Name | [(2S)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 95040569 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [(2S)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]urea |
| SMILES | C[C@H](NC(N)=O)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C12H14N4O3/c1-7(14-12(13)19)11(18)16-6-10(17)15-8-4-2-3-5-9(8)16/h2-5,7H,6H2,1H3,(H,15,17)(H3,13,14,19)/t7-/m0/s1 |
| InChIKey | JWCRZOFOZKDYHQ-ZETCQYMHSA-N |
| XLogP | 0.03 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |