C14H19N3O2 — CID 61148811
4-[(2S)-2-amino-3,3-dimethylbutanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 61148811) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 61148811 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[(2S)-2-amino-3,3-dimethylbutanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,3)12(15)13(19)17-8-11(18)16-9-6-4-5-7-10(9)17/h4-7,12H,8,15H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | URBJDGCRNRJUHO-GFCCVEGCSA-N |
| XLogP | 1.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |