C11H11BrN2O2 — CID 107902910
4-(2-bromopropanoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 107902910) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is 4-(2-bromopropanoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(2-bromopropanoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 107902910 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 4-(2-bromopropanoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | CC(Br)C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C11H11BrN2O2/c1-7(12)11(16)14-6-10(15)13-8-4-2-3-5-9(8)14/h2-5,7H,6H2,1H3,(H,13,15) |
| InChIKey | VGIBKZNAZPTCTK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|