C18H18N2O2S — CID 16863999
4-(4-phenylsulfanylbutanoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 16863999) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-(4-phenylsulfanylbutanoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(4-phenylsulfanylbutanoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 16863999 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-(4-phenylsulfanylbutanoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)CCCSc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C18H18N2O2S/c21-17-13-20(16-10-5-4-9-15(16)19-17)18(22)11-6-12-23-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2,(H,19,21) |
| InChIKey | LIDIAUCLGBXMRR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|