C14H19N3O2 — CID 28822275
4-(6-aminohexanoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 28822275) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-(6-aminohexanoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(6-aminohexanoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 28822275 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-(6-aminohexanoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | NCCCCCC(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2/c15-9-5-1-2-8-14(19)17-10-13(18)16-11-6-3-4-7-12(11)17/h3-4,6-7H,1-2,5,8-10,15H2,(H,16,18) |
| InChIKey | GWCRJJQOSDKPOS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|