C20H28N4O4 — CID 119663727
1-[4-(3-aminopropoxy)piperidin-1-yl]-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butane-1,4-dione (PubChem CID 119663727) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butane-1,4-dione.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 119663727 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)butane-1,4-dione |
| SMILES | NCCCOC1CCN(C(=O)CCC(=O)N2CC(=O)Nc3ccccc32)CC1 |
| InChI | InChI=1S/C20H28N4O4/c21-10-3-13-28-15-8-11-23(12-9-15)19(26)6-7-20(27)24-14-18(25)22-16-4-1-2-5-17(16)24/h1-2,4-5,15H,3,6-14,21H2,(H,22,25) |
| InChIKey | RIIQDFXRHUHWOV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|