C13H15N3O3S — CID 60734018
2-[3-oxo-3-(3-oxo-2,4-dihydroquinoxalin-1-yl)propyl]sulfanylacetamide (PubChem CID 60734018) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-[3-oxo-3-(3-oxo-2,4-dihydroquinoxalin-1-yl)propyl]sulfanylacetamide.
| Compound Name | 2-[3-oxo-3-(3-oxo-2,4-dihydroquinoxalin-1-yl)propyl]sulfanylacetamide |
|---|---|
| PubChem CID | 60734018 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[3-oxo-3-(3-oxo-2,4-dihydroquinoxalin-1-yl)propyl]sulfanylacetamide |
| SMILES | NC(=O)CSCCC(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C13H15N3O3S/c14-11(17)8-20-6-5-13(19)16-7-12(18)15-9-3-1-2-4-10(9)16/h1-4H,5-8H2,(H2,14,17)(H,15,18) |
| InChIKey | AYIUFQXWNKNQSH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|