C16H14N2O3 — CID 61399698
4-[2-(3-hydroxyphenyl)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 61399698) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[2-(3-hydroxyphenyl)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(3-hydroxyphenyl)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 61399698 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[2-(3-hydroxyphenyl)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)Cc2cccc(O)c2)c2ccccc2N1 |
| InChI | InChI=1S/C16H14N2O3/c19-12-5-3-4-11(8-12)9-16(21)18-10-15(20)17-13-6-1-2-7-14(13)18/h1-8,19H,9-10H2,(H,17,20) |
| InChIKey | WVVUVGQWLDERME-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |