C17H16N2O3 — CID 26263034
4-[3-(methoxymethyl)benzoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 26263034) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-[3-(methoxymethyl)benzoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[3-(methoxymethyl)benzoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 26263034 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-[3-(methoxymethyl)benzoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | COCc1cccc(C(=O)N2CC(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-22-11-12-5-4-6-13(9-12)17(21)19-10-16(20)18-14-7-2-3-8-15(14)19/h2-9H,10-11H2,1H3,(H,18,20) |
| InChIKey | OKUYHYWFRSRVQT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |