C15H12N2O4 — CID 103956224
4-(3,4-dihydroxybenzoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 103956224) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-(3,4-dihydroxybenzoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(3,4-dihydroxybenzoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 103956224 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(3,4-dihydroxybenzoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc(O)c(O)c2)c2ccccc2N1 |
| InChI | InChI=1S/C15H12N2O4/c18-12-6-5-9(7-13(12)19)15(21)17-8-14(20)16-10-3-1-2-4-11(10)17/h1-7,18-19H,8H2,(H,16,20) |
| InChIKey | UMYZVJGFOVKJMD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|