C23H16N2O4 — CID 2445640
1-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]-2-phenylethane-1,2-dione (PubChem CID 2445640) has the molecular formula C23H16N2O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 2445640 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]-2-phenylethane-1,2-dione |
| SMILES | O=C1CN(C(=O)c2ccc(C(=O)C(=O)c3ccccc3)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C23H16N2O4/c26-20-14-25(19-9-5-4-8-18(19)24-20)23(29)17-12-10-16(11-13-17)22(28)21(27)15-6-2-1-3-7-15/h1-13H,14H2,(H,24,26) |
| InChIKey | SYGMZEWEZGWDFS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|