C15H11FN2O2 — CID 3159804
4-(3-fluorobenzoyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 3159804) has the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-(3-fluorobenzoyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(3-fluorobenzoyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 3159804 |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4-(3-fluorobenzoyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)c2cccc(F)c2)c2ccccc2N1 |
| InChI | InChI=1S/C15H11FN2O2/c16-11-5-3-4-10(8-11)15(20)18-9-14(19)17-12-6-1-2-7-13(12)18/h1-8H,9H2,(H,17,19) |
| InChIKey | ODRDIOPJBQURDH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |