C18H31N3O3 — CID 163261655
ethane;4-[3-(2-hydroxyethylamino)propanoyl]-1,3-dihydroquinoxalin-2-one;propane (PubChem CID 163261655) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is ethane;4-[3-(2-hydroxyethylamino)propanoyl]-1,3-dihydroquinoxalin-2-one;propane.
| Compound Name | ethane;4-[3-(2-hydroxyethylamino)propanoyl]-1,3-dihydroquinoxalin-2-one;propane |
|---|---|
| PubChem CID | 163261655 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | ethane;4-[3-(2-hydroxyethylamino)propanoyl]-1,3-dihydroquinoxalin-2-one;propane |
| SMILES | CC.CCC.O=C1CN(C(=O)CCNCCO)c2ccccc2N1 |
| InChI | InChI=1S/C13H17N3O3.C3H8.C2H6/c17-8-7-14-6-5-13(19)16-9-12(18)15-10-3-1-2-4-11(10)16;1-3-2;1-2/h1-4,14,17H,5-9H2,(H,15,18);3H2,1-2H3;1-2H3 |
| InChIKey | OZFMHZVAXOEBEG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|