methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate

C13H15NO3 — CID 28940061

IUPACmethyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate
SMILESCOC(=O)CCN1C(=O)CCc2ccccc21
InChIInChI=1S/C13H15NO3/c1-17-13(16)8-9-14-11-5-3-2-4-10(11)6-7-12(14)15/h2-5H,6-9H2,1H3
InChIKeyGTULRPRGYIIUFH-UHFFFAOYSA-N
MW233.27 g/mol
LogP1.53
Rot. Bonds3

About methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate

methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate (PubChem CID 28940061) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate
PubChem CID28940061
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Namemethyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate
SMILESCOC(=O)CCN1C(=O)CCc2ccccc21
InChIInChI=1S/C13H15NO3/c1-17-13(16)8-9-14-11-5-3-2-4-10(11)6-7-12(14)15/h2-5H,6-9H2,1H3
InChIKeyGTULRPRGYIIUFH-UHFFFAOYSA-N
XLogP1.53
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 51.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate?
The IUPAC name of methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate (CID 28940061) is methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate.
What is the SMILES notation for methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate?
The canonical SMILES for methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate is COC(=O)CCN1C(=O)CCc2ccccc21.
What is the InChIKey of methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate?
The InChIKey is GTULRPRGYIIUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-17-13(16)8-9-14-11-5-3-2-4-10(11)6-7-12(14)15/h2-5H,6-9H2,1H3.
What are the key properties of methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate?
methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate has a molecular weight of 233.27 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-oxo-3,4-dihydroquinolin-1-yl)propanoate is sourced from PubChem (CID 28940061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).