C13H17NO2 — CID 43509835
1-(4-hydroxybutyl)-3,4-dihydroquinolin-2-one (PubChem CID 43509835) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(4-hydroxybutyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 43509835 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(4-hydroxybutyl)-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1CCCCO |
| InChI | InChI=1S/C13H17NO2/c15-10-4-3-9-14-12-6-2-1-5-11(12)7-8-13(14)16/h1-2,5-6,15H,3-4,7-10H2 |
| InChIKey | IPRLADWEXSWCBA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|