C15H19NO3 — CID 43342822
5-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)pentanoic acid (PubChem CID 43342822) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)pentanoic acid.
| Compound Name | 5-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 43342822 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)pentanoic acid |
| SMILES | O=C(O)CCCCN1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C15H19NO3/c17-14-9-5-7-12-6-1-2-8-13(12)16(14)11-4-3-10-15(18)19/h1-2,6,8H,3-5,7,9-11H2,(H,18,19) |
| InChIKey | RSIDCYKNGVKEKQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|