C14H15NO3 — CID 55065477
(E)-4-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)but-2-enoic acid (PubChem CID 55065477) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (E)-4-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)but-2-enoic acid.
| Compound Name | (E)-4-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 55065477 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (E)-4-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C14H15NO3/c16-13-8-3-6-11-5-1-2-7-12(11)15(13)10-4-9-14(17)18/h1-2,4-5,7,9H,3,6,8,10H2,(H,17,18)/b9-4+ |
| InChIKey | LYTBHOTXMHULQF-RUDMXATFSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|