4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid

C13H15NO2 — CID 76940722

IUPAC4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid
SMILESO=C(O)C=CCN1CCc2ccccc2C1
InChIInChI=1S/C13H15NO2/c15-13(16)6-3-8-14-9-7-11-4-1-2-5-12(11)10-14/h1-6H,7-10H2,(H,15,16)
InChIKeyYFSQISMHRUDNQH-UHFFFAOYSA-N
MW217.27 g/mol
LogP1.69
Rot. Bonds3

About 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid

4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid (PubChem CID 76940722) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid.

Molecular Properties

Compound Name4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid
PubChem CID76940722
Molecular FormulaC13H15NO2
Molecular Weight217.27 g/mol
Exact Mass217.11
IUPAC Name4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid
SMILESO=C(O)C=CCN1CCc2ccccc2C1
InChIInChI=1S/C13H15NO2/c15-13(16)6-3-8-14-9-7-11-4-1-2-5-12(11)10-14/h1-6H,7-10H2,(H,15,16)
InChIKeyYFSQISMHRUDNQH-UHFFFAOYSA-N
XLogP1.69
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.27
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid?
The IUPAC name of 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid (CID 76940722) is 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid.
What is the SMILES notation for 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid?
The canonical SMILES for 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid is O=C(O)C=CCN1CCc2ccccc2C1.
What is the InChIKey of 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid?
The InChIKey is YFSQISMHRUDNQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c15-13(16)6-3-8-14-9-7-11-4-1-2-5-12(11)10-14/h1-6H,7-10H2,(H,15,16).
What are the key properties of 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid?
4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid has a molecular weight of 217.27 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-enoic acid is sourced from PubChem (CID 76940722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).