C24H32N2O8 — CID 14405660
bis((E)-but-2-enedioic acid);2-[(1-methylpiperidin-4-yl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 14405660) has the molecular formula C24H32N2O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);2-[(1-methylpiperidin-4-yl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | bis((E)-but-2-enedioic acid);2-[(1-methylpiperidin-4-yl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 14405660 |
| Molecular Formula | C24H32N2O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | bis((E)-but-2-enedioic acid);2-[(1-methylpiperidin-4-yl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCC(CN2CCc3ccccc3C2)CC1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H24N2.2C4H4O4/c1-17-9-6-14(7-10-17)12-18-11-8-15-4-2-3-5-16(15)13-18;2*5-3(6)1-2-4(7)8/h2-5,14H,6-13H2,1H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | FQTWFYBHGXECOT-LVEZLNDCSA-N |
| XLogP | 1.81 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|