C24H28N2O5S — CID 23039550
(E)-but-2-enedioic acid;[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 23039550) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | (E)-but-2-enedioic acid;[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 23039550 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (E)-but-2-enedioic acid;[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(O)/C=C/C(=O)O.O=C(c1ccsc1)N1CCC(CN2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C20H24N2OS.C4H4O4/c23-20(19-8-12-24-15-19)22-10-5-16(6-11-22)13-21-9-7-17-3-1-2-4-18(17)14-21;5-3(6)1-2-4(7)8/h1-4,8,12,15-16H,5-7,9-11,13-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HVNQRHFRXQVWBN-WLHGVMLRSA-N |
| XLogP | 3.37 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|