C15H23N3OS — CID 119930739
[4-(piperidin-4-ylmethyl)piperazin-1-yl]-thiophen-3-ylmethanone (PubChem CID 119930739) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is [4-(piperidin-4-ylmethyl)piperazin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(piperidin-4-ylmethyl)piperazin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 119930739 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [4-(piperidin-4-ylmethyl)piperazin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C15H23N3OS/c19-15(14-3-10-20-12-14)18-8-6-17(7-9-18)11-13-1-4-16-5-2-13/h3,10,12-13,16H,1-2,4-9,11H2 |
| InChIKey | ZUXFOXLWJWSRAH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |