C14H20ClN3O2S — CID 119298898
[(2S)-pyrrolidin-2-yl]-[4-(thiophene-3-carbonyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119298898) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is [(2S)-pyrrolidin-2-yl]-[4-(thiophene-3-carbonyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | [(2S)-pyrrolidin-2-yl]-[4-(thiophene-3-carbonyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119298898 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [(2S)-pyrrolidin-2-yl]-[4-(thiophene-3-carbonyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccsc1)N1CCN(C(=O)[C@@H]2CCCN2)CC1 |
| InChI | InChI=1S/C14H19N3O2S.ClH/c18-13(11-3-9-20-10-11)16-5-7-17(8-6-16)14(19)12-2-1-4-15-12;/h3,9-10,12,15H,1-2,4-8H2;1H/t12-;/m0./s1 |
| InChIKey | IPINIHZRATZVLI-YDALLXLXSA-N |
| XLogP | 1.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |