C17H23ClFN3O2 — CID 119282032
[4-(3-fluorobenzoyl)piperazin-1-yl]-piperidin-2-ylmethanone;hydrochloride (PubChem CID 119282032) has the molecular formula C17H23ClFN3O2 and a molecular weight of 355.84 g/mol. Its IUPAC name is [4-(3-fluorobenzoyl)piperazin-1-yl]-piperidin-2-ylmethanone;hydrochloride.
| Compound Name | [4-(3-fluorobenzoyl)piperazin-1-yl]-piperidin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119282032 |
| Molecular Formula | C17H23ClFN3O2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [4-(3-fluorobenzoyl)piperazin-1-yl]-piperidin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc(F)c1)N1CCN(C(=O)C2CCCCN2)CC1 |
| InChI | InChI=1S/C17H22FN3O2.ClH/c18-14-5-3-4-13(12-14)16(22)20-8-10-21(11-9-20)17(23)15-6-1-2-7-19-15;/h3-5,12,15,19H,1-2,6-11H2;1H |
| InChIKey | ZCSJLRXBNZCTQJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |