C15H22ClN3O2S — CID 119689038
[(2S)-piperidin-2-yl]-[4-(thiophene-2-carbonyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119689038) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is [(2S)-piperidin-2-yl]-[4-(thiophene-2-carbonyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | [(2S)-piperidin-2-yl]-[4-(thiophene-2-carbonyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119689038 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [(2S)-piperidin-2-yl]-[4-(thiophene-2-carbonyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccs1)N1CCN(C(=O)[C@@H]2CCCCN2)CC1 |
| InChI | InChI=1S/C15H21N3O2S.ClH/c19-14(12-4-1-2-6-16-12)17-7-9-18(10-8-17)15(20)13-5-3-11-21-13;/h3,5,11-12,16H,1-2,4,6-10H2;1H/t12-;/m0./s1 |
| InChIKey | LQDAOOOOPRAIAL-YDALLXLXSA-N |
| XLogP | 1.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |